C19H15FN4S — CID 123636824
2-(4-fluorophenyl)sulfanyl-N-(5-methyl-1H-pyrazol-3-yl)quinolin-4-amine (PubChem CID 123636824) has the molecular formula C19H15FN4S and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-(4-fluorophenyl)sulfanyl-N-(5-methyl-1H-pyrazol-3-yl)quinolin-4-amine.
| Compound Name | 2-(4-fluorophenyl)sulfanyl-N-(5-methyl-1H-pyrazol-3-yl)quinolin-4-amine |
|---|---|
| PubChem CID | 123636824 |
| Molecular Formula | C19H15FN4S |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 2-(4-fluorophenyl)sulfanyl-N-(5-methyl-1H-pyrazol-3-yl)quinolin-4-amine |
| SMILES | Cc1cc(Nc2cc(Sc3ccc(F)cc3)nc3ccccc23)n[nH]1 |
| InChI | InChI=1S/C19H15FN4S/c1-12-10-18(24-23-12)21-17-11-19(22-16-5-3-2-4-15(16)17)25-14-8-6-13(20)7-9-14/h2-11H,1H3,(H2,21,22,23,24) |
| InChIKey | WMJUMBRGZFOJOH-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |