C21H17FN4 — CID 90918751
1-(4-fluorophenyl)-1-methyl-N-(5-methyl-1H-pyrazol-3-yl)cyclopropa[b]quinolin-7-amine (PubChem CID 90918751) has the molecular formula C21H17FN4 and a molecular weight of 344.39 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-1-methyl-N-(5-methyl-1H-pyrazol-3-yl)cyclopropa[b]quinolin-7-amine.
| Compound Name | 1-(4-fluorophenyl)-1-methyl-N-(5-methyl-1H-pyrazol-3-yl)cyclopropa[b]quinolin-7-amine |
|---|---|
| PubChem CID | 90918751 |
| Molecular Formula | C21H17FN4 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 1-(4-fluorophenyl)-1-methyl-N-(5-methyl-1H-pyrazol-3-yl)cyclopropa[b]quinolin-7-amine |
| SMILES | Cc1cc(Nc2c3c(nc4ccccc24)C3(C)c2ccc(F)cc2)n[nH]1 |
| InChI | InChI=1S/C21H17FN4/c1-12-11-17(26-25-12)24-19-15-5-3-4-6-16(15)23-20-18(19)21(20,2)13-7-9-14(22)10-8-13/h3-11H,1-2H3,(H2,23,24,25,26) |
| InChIKey | SJONPXZQQOTCHO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |