C13H16N2 — CID 159318650
4,6-dimethyl-2-phenylpyrimidine;methane (PubChem CID 159318650) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 4,6-dimethyl-2-phenylpyrimidine;methane.
| Compound Name | 4,6-dimethyl-2-phenylpyrimidine;methane |
|---|---|
| PubChem CID | 159318650 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 4,6-dimethyl-2-phenylpyrimidine;methane |
| SMILES | C.Cc1cc(C)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C12H12N2.CH4/c1-9-8-10(2)14-12(13-9)11-6-4-3-5-7-11;/h3-8H,1-2H3;1H4 |
| InChIKey | LDLWYWALLGBKLS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |