C23H18N2 — CID 121360265
4-methyl-2-phenyl-6-(3-phenylphenyl)pyrimidine (PubChem CID 121360265) has the molecular formula C23H18N2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 4-methyl-2-phenyl-6-(3-phenylphenyl)pyrimidine.
| Compound Name | 4-methyl-2-phenyl-6-(3-phenylphenyl)pyrimidine |
|---|---|
| PubChem CID | 121360265 |
| Molecular Formula | C23H18N2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 4-methyl-2-phenyl-6-(3-phenylphenyl)pyrimidine |
| SMILES | Cc1cc(-c2cccc(-c3ccccc3)c2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H18N2/c1-17-15-22(25-23(24-17)19-11-6-3-7-12-19)21-14-8-13-20(16-21)18-9-4-2-5-10-18/h2-16H,1H3 |
| InChIKey | RUWRKFKNWNEMPS-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |