C53H37N5 — CID 118895278
2-[3-anthracen-9-yl-5-[4-[4-(4,6-dimethylpyrimidin-2-yl)phenyl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 118895278) has the molecular formula C53H37N5 and a molecular weight of 743.91 g/mol. Its IUPAC name is 2-[3-anthracen-9-yl-5-[4-[4-(4,6-dimethylpyrimidin-2-yl)phenyl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-anthracen-9-yl-5-[4-[4-(4,6-dimethylpyrimidin-2-yl)phenyl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 118895278 |
| Molecular Formula | C53H37N5 |
| Molecular Weight | 743.91 g/mol |
| Exact Mass | 743.30 |
| IUPAC Name | 2-[3-anthracen-9-yl-5-[4-[4-(4,6-dimethylpyrimidin-2-yl)phenyl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | Cc1cc(C)nc(-c2ccc(-c3ccc(-c4cc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc(-c5c6ccccc6cc6ccccc56)c4)cc3)cc2)n1 |
| InChI | InChI=1S/C53H37N5/c1-34-29-35(2)55-50(54-34)41-27-25-37(26-28-41)36-21-23-38(24-22-36)44-31-45(49-47-19-11-9-17-42(47)30-43-18-10-12-20-48(43)49)33-46(32-44)53-57-51(39-13-5-3-6-14-39)56-52(58-53)40-15-7-4-8-16-40/h3-33H,1-2H3 |
| InChIKey | URGKOYPQIVGEOK-UHFFFAOYSA-N |
| XLogP | 13.25 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.91 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|