C23H25N7O4 — CID 117091578
2-(6-morpholin-4-yl-3-pyridinyl)-N-(3,4,5-trimethoxyphenyl)-7H-purin-6-amine (PubChem CID 117091578) has the molecular formula C23H25N7O4 and a molecular weight of 463.50 g/mol. Its IUPAC name is 2-(6-morpholin-4-yl-3-pyridinyl)-N-(3,4,5-trimethoxyphenyl)-7H-purin-6-amine.
| Compound Name | 2-(6-morpholin-4-yl-3-pyridinyl)-N-(3,4,5-trimethoxyphenyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 117091578 |
| Molecular Formula | C23H25N7O4 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 2-(6-morpholin-4-yl-3-pyridinyl)-N-(3,4,5-trimethoxyphenyl)-7H-purin-6-amine |
| SMILES | COc1cc(Nc2nc(-c3ccc(N4CCOCC4)nc3)nc3nc[nH]c23)cc(OC)c1OC |
| InChI | InChI=1S/C23H25N7O4/c1-31-16-10-15(11-17(32-2)20(16)33-3)27-23-19-22(26-13-25-19)28-21(29-23)14-4-5-18(24-12-14)30-6-8-34-9-7-30/h4-5,10-13H,6-9H2,1-3H3,(H2,25,26,27,28,29) |
| InChIKey | BXJWFOLMACEDLE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 119.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |