C21H21N7O — CID 117079432
2-(3-aminophenyl)-N-(4-morpholin-4-ylphenyl)-7H-purin-6-amine (PubChem CID 117079432) has the molecular formula C21H21N7O and a molecular weight of 387.45 g/mol. Its IUPAC name is 2-(3-aminophenyl)-N-(4-morpholin-4-ylphenyl)-7H-purin-6-amine.
| Compound Name | 2-(3-aminophenyl)-N-(4-morpholin-4-ylphenyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 117079432 |
| Molecular Formula | C21H21N7O |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 2-(3-aminophenyl)-N-(4-morpholin-4-ylphenyl)-7H-purin-6-amine |
| SMILES | Nc1cccc(-c2nc(Nc3ccc(N4CCOCC4)cc3)c3[nH]cnc3n2)c1 |
| InChI | InChI=1S/C21H21N7O/c22-15-3-1-2-14(12-15)19-26-20-18(23-13-24-20)21(27-19)25-16-4-6-17(7-5-16)28-8-10-29-11-9-28/h1-7,12-13H,8-11,22H2,(H2,23,24,25,26,27) |
| InChIKey | LXIWHOGSRROOLR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|