C22H19F3N6O — CID 71138160
N-(4-morpholin-4-ylphenyl)-5-[3-(trifluoromethyl)phenyl]-1H-pyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 71138160) has the molecular formula C22H19F3N6O and a molecular weight of 440.43 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-5-[3-(trifluoromethyl)phenyl]-1H-pyrazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | N-(4-morpholin-4-ylphenyl)-5-[3-(trifluoromethyl)phenyl]-1H-pyrazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 71138160 |
| Molecular Formula | C22H19F3N6O |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-5-[3-(trifluoromethyl)phenyl]-1H-pyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | FC(F)(F)c1cccc(-c2nc(Nc3ccc(N4CCOCC4)cc3)c3[nH]ncc3n2)c1 |
| InChI | InChI=1S/C22H19F3N6O/c23-22(24,25)15-3-1-2-14(12-15)20-28-18-13-26-30-19(18)21(29-20)27-16-4-6-17(7-5-16)31-8-10-32-11-9-31/h1-7,12-13H,8-11H2,(H,26,30)(H,27,28,29) |
| InChIKey | LZRVWKSOIUIDBU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|