C21H22N8 — CID 71138076
N-[4-(4-methylpiperazin-1-yl)phenyl]-5-pyridin-4-yl-1H-pyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 71138076) has the molecular formula C21H22N8 and a molecular weight of 386.46 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-5-pyridin-4-yl-1H-pyrazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-5-pyridin-4-yl-1H-pyrazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 71138076 |
| Molecular Formula | C21H22N8 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-5-pyridin-4-yl-1H-pyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CN1CCN(c2ccc(Nc3nc(-c4ccncc4)nc4cn[nH]c34)cc2)CC1 |
| InChI | InChI=1S/C21H22N8/c1-28-10-12-29(13-11-28)17-4-2-16(3-5-17)24-21-19-18(14-23-27-19)25-20(26-21)15-6-8-22-9-7-15/h2-9,14H,10-13H2,1H3,(H,23,27)(H,24,25,26) |
| InChIKey | ZSQKPDCHLPGPFS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|