C26H31N7O — CID 71138126
N-[4-(4-tert-butylpiperazin-1-yl)phenyl]-5-(4-methoxyphenyl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 71138126) has the molecular formula C26H31N7O and a molecular weight of 457.58 g/mol. Its IUPAC name is N-[4-(4-tert-butylpiperazin-1-yl)phenyl]-5-(4-methoxyphenyl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | N-[4-(4-tert-butylpiperazin-1-yl)phenyl]-5-(4-methoxyphenyl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 71138126 |
| Molecular Formula | C26H31N7O |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | N-[4-(4-tert-butylpiperazin-1-yl)phenyl]-5-(4-methoxyphenyl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | COc1ccc(-c2nc(Nc3ccc(N4CCN(C(C)(C)C)CC4)cc3)c3[nH]ncc3n2)cc1 |
| InChI | InChI=1S/C26H31N7O/c1-26(2,3)33-15-13-32(14-16-33)20-9-7-19(8-10-20)28-25-23-22(17-27-31-23)29-24(30-25)18-5-11-21(34-4)12-6-18/h5-12,17H,13-16H2,1-4H3,(H,27,31)(H,28,29,30) |
| InChIKey | GXDAHKGHCOQLHQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 82.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|