C17H17N9O — CID 90104809
N-(4-morpholin-4-ylphenyl)-5-(1H-1,2,4-triazol-5-yl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 90104809) has the molecular formula C17H17N9O and a molecular weight of 363.39 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-5-(1H-1,2,4-triazol-5-yl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | N-(4-morpholin-4-ylphenyl)-5-(1H-1,2,4-triazol-5-yl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 90104809 |
| Molecular Formula | C17H17N9O |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-5-(1H-1,2,4-triazol-5-yl)-1H-pyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | c1n[nH]c(-c2nc(Nc3ccc(N4CCOCC4)cc3)c3[nH]ncc3n2)n1 |
| InChI | InChI=1S/C17H17N9O/c1-3-12(26-5-7-27-8-6-26)4-2-11(1)21-15-14-13(9-19-24-14)22-17(23-15)16-18-10-20-25-16/h1-4,9-10H,5-8H2,(H,19,24)(H,18,20,25)(H,21,22,23) |
| InChIKey | QTJWZQWGGQLCKO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 120.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|