C17H16N6S — CID 71138143
4-N,4-N-dimethyl-1-N-(5-thiophen-3-yl-1H-pyrazolo[4,5-d]pyrimidin-7-yl)benzene-1,4-diamine (PubChem CID 71138143) has the molecular formula C17H16N6S and a molecular weight of 336.42 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-1-N-(5-thiophen-3-yl-1H-pyrazolo[4,5-d]pyrimidin-7-yl)benzene-1,4-diamine.
| Compound Name | 4-N,4-N-dimethyl-1-N-(5-thiophen-3-yl-1H-pyrazolo[4,5-d]pyrimidin-7-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 71138143 |
| Molecular Formula | C17H16N6S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 4-N,4-N-dimethyl-1-N-(5-thiophen-3-yl-1H-pyrazolo[4,5-d]pyrimidin-7-yl)benzene-1,4-diamine |
| SMILES | CN(C)c1ccc(Nc2nc(-c3ccsc3)nc3cn[nH]c23)cc1 |
| InChI | InChI=1S/C17H16N6S/c1-23(2)13-5-3-12(4-6-13)19-17-15-14(9-18-22-15)20-16(21-17)11-7-8-24-10-11/h3-10H,1-2H3,(H,18,22)(H,19,20,21) |
| InChIKey | PIPCJQVPYTYNKF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|