C23H20N6 — CID 10156619
2-[4-(dimethylamino)phenyl]-N-(1H-indazol-5-yl)quinazolin-4-amine (PubChem CID 10156619) has the molecular formula C23H20N6 and a molecular weight of 380.46 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]-N-(1H-indazol-5-yl)quinazolin-4-amine.
| Compound Name | 2-[4-(dimethylamino)phenyl]-N-(1H-indazol-5-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 10156619 |
| Molecular Formula | C23H20N6 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]-N-(1H-indazol-5-yl)quinazolin-4-amine |
| SMILES | CN(C)c1ccc(-c2nc(Nc3ccc4[nH]ncc4c3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C23H20N6/c1-29(2)18-10-7-15(8-11-18)22-26-21-6-4-3-5-19(21)23(27-22)25-17-9-12-20-16(13-17)14-24-28-20/h3-14H,1-2H3,(H,24,28)(H,25,26,27) |
| InChIKey | UEKDDZXVMFYRBX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |