C25H21N5O2 — CID 59361940
[3-[4-(1H-indazol-5-ylamino)quinazolin-2-yl]phenyl] butanoate (PubChem CID 59361940) has the molecular formula C25H21N5O2 and a molecular weight of 423.48 g/mol. Its IUPAC name is [3-[4-(1H-indazol-5-ylamino)quinazolin-2-yl]phenyl] butanoate.
| Compound Name | [3-[4-(1H-indazol-5-ylamino)quinazolin-2-yl]phenyl] butanoate |
|---|---|
| PubChem CID | 59361940 |
| Molecular Formula | C25H21N5O2 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | [3-[4-(1H-indazol-5-ylamino)quinazolin-2-yl]phenyl] butanoate |
| SMILES | CCCC(=O)Oc1cccc(-c2nc(Nc3ccc4[nH]ncc4c3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C25H21N5O2/c1-2-6-23(31)32-19-8-5-7-16(14-19)24-28-22-10-4-3-9-20(22)25(29-24)27-18-11-12-21-17(13-18)15-26-30-21/h3-5,7-15H,2,6H2,1H3,(H,26,30)(H,27,28,29) |
| InChIKey | WZWBQRCMIMNTNG-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|