C27H26N8O — CID 11950701
N-[3-[4-(1H-indazol-5-ylamino)quinazolin-2-yl]phenyl]-4-methylpiperazine-1-carboxamide (PubChem CID 11950701) has the molecular formula C27H26N8O and a molecular weight of 478.56 g/mol. Its IUPAC name is N-[3-[4-(1H-indazol-5-ylamino)quinazolin-2-yl]phenyl]-4-methylpiperazine-1-carboxamide.
| Compound Name | N-[3-[4-(1H-indazol-5-ylamino)quinazolin-2-yl]phenyl]-4-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 11950701 |
| Molecular Formula | C27H26N8O |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | N-[3-[4-(1H-indazol-5-ylamino)quinazolin-2-yl]phenyl]-4-methylpiperazine-1-carboxamide |
| SMILES | CN1CCN(C(=O)Nc2cccc(-c3nc(Nc4ccc5[nH]ncc5c4)c4ccccc4n3)c2)CC1 |
| InChI | InChI=1S/C27H26N8O/c1-34-11-13-35(14-12-34)27(36)30-20-6-4-5-18(15-20)25-31-24-8-3-2-7-22(24)26(32-25)29-21-9-10-23-19(16-21)17-28-33-23/h2-10,15-17H,11-14H2,1H3,(H,28,33)(H,30,36)(H,29,31,32) |
| InChIKey | FKGASPODRFALEE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 102.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |