C25H23N7O — CID 59361917
2-(dimethylamino)-N-[3-[4-(1H-indazol-5-ylamino)quinazolin-2-yl]phenyl]acetamide (PubChem CID 59361917) has the molecular formula C25H23N7O and a molecular weight of 437.51 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[3-[4-(1H-indazol-5-ylamino)quinazolin-2-yl]phenyl]acetamide.
| Compound Name | 2-(dimethylamino)-N-[3-[4-(1H-indazol-5-ylamino)quinazolin-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 59361917 |
| Molecular Formula | C25H23N7O |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 2-(dimethylamino)-N-[3-[4-(1H-indazol-5-ylamino)quinazolin-2-yl]phenyl]acetamide |
| SMILES | CN(C)CC(=O)Nc1cccc(-c2nc(Nc3ccc4[nH]ncc4c3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C25H23N7O/c1-32(2)15-23(33)27-18-7-5-6-16(12-18)24-29-22-9-4-3-8-20(22)25(30-24)28-19-10-11-21-17(13-19)14-26-31-21/h3-14H,15H2,1-2H3,(H,26,31)(H,27,33)(H,28,29,30) |
| InChIKey | BSGCXVNYZAZHGZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |