C30H33N7O2 — CID 25014425
N-[3-[6-[3-(dimethylamino)propoxy]-4-(1H-indazol-5-ylamino)quinazolin-2-yl]phenyl]butanamide (PubChem CID 25014425) has the molecular formula C30H33N7O2 and a molecular weight of 523.64 g/mol. Its IUPAC name is N-[3-[6-[3-(dimethylamino)propoxy]-4-(1H-indazol-5-ylamino)quinazolin-2-yl]phenyl]butanamide.
| Compound Name | N-[3-[6-[3-(dimethylamino)propoxy]-4-(1H-indazol-5-ylamino)quinazolin-2-yl]phenyl]butanamide |
|---|---|
| PubChem CID | 25014425 |
| Molecular Formula | C30H33N7O2 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | N-[3-[6-[3-(dimethylamino)propoxy]-4-(1H-indazol-5-ylamino)quinazolin-2-yl]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1cccc(-c2nc(Nc3ccc4[nH]ncc4c3)c3cc(OCCCN(C)C)ccc3n2)c1 |
| InChI | InChI=1S/C30H33N7O2/c1-4-7-28(38)32-22-9-5-8-20(16-22)29-34-27-13-11-24(39-15-6-14-37(2)3)18-25(27)30(35-29)33-23-10-12-26-21(17-23)19-31-36-26/h5,8-13,16-19H,4,6-7,14-15H2,1-3H3,(H,31,36)(H,32,38)(H,33,34,35) |
| InChIKey | ZGJCPUWSTXPZNG-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|