C30H29N5O2 — CID 157346786
N-[3-[6-(cyclopropylmethoxy)-4-(1H-isoindol-5-ylamino)quinazolin-2-yl]phenyl]butanamide (PubChem CID 157346786) has the molecular formula C30H29N5O2 and a molecular weight of 491.60 g/mol. Its IUPAC name is N-[3-[6-(cyclopropylmethoxy)-4-(1H-isoindol-5-ylamino)quinazolin-2-yl]phenyl]butanamide.
| Compound Name | N-[3-[6-(cyclopropylmethoxy)-4-(1H-isoindol-5-ylamino)quinazolin-2-yl]phenyl]butanamide |
|---|---|
| PubChem CID | 157346786 |
| Molecular Formula | C30H29N5O2 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | N-[3-[6-(cyclopropylmethoxy)-4-(1H-isoindol-5-ylamino)quinazolin-2-yl]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1cccc(-c2nc(Nc3ccc4c(c3)C=NC4)c3cc(OCC4CC4)ccc3n2)c1 |
| InChI | InChI=1S/C30H29N5O2/c1-2-4-28(36)32-23-6-3-5-20(13-23)29-34-27-12-11-25(37-18-19-7-8-19)15-26(27)30(35-29)33-24-10-9-21-16-31-17-22(21)14-24/h3,5-6,9-15,17,19H,2,4,7-8,16,18H2,1H3,(H,32,36)(H,33,34,35) |
| InChIKey | BHBHNNGBXBFQMV-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 88.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |