C30H32N6O4 — CID 134345065
3-[[4-[3-methyl-4-(2-methylidenehydrazinyl)anilino]-2-[3-[(3-propyloxiran-2-yl)amino]phenyl]quinazolin-6-yl]oxymethyl]oxiran-2-ol (PubChem CID 134345065) has the molecular formula C30H32N6O4 and a molecular weight of 540.62 g/mol. Its IUPAC name is 3-[[4-[3-methyl-4-(2-methylidenehydrazinyl)anilino]-2-[3-[(3-propyloxiran-2-yl)amino]phenyl]quinazolin-6-yl]oxymethyl]oxiran-2-ol.
| Compound Name | 3-[[4-[3-methyl-4-(2-methylidenehydrazinyl)anilino]-2-[3-[(3-propyloxiran-2-yl)amino]phenyl]quinazolin-6-yl]oxymethyl]oxiran-2-ol |
|---|---|
| PubChem CID | 134345065 |
| Molecular Formula | C30H32N6O4 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | 3-[[4-[3-methyl-4-(2-methylidenehydrazinyl)anilino]-2-[3-[(3-propyloxiran-2-yl)amino]phenyl]quinazolin-6-yl]oxymethyl]oxiran-2-ol |
| SMILES | C=NNc1ccc(Nc2nc(-c3cccc(NC4OC4CCC)c3)nc3ccc(OCC4OC4O)cc23)cc1C |
| InChI | InChI=1S/C30H32N6O4/c1-4-6-25-29(39-25)33-19-8-5-7-18(14-19)27-34-24-12-10-21(38-16-26-30(37)40-26)15-22(24)28(35-27)32-20-9-11-23(36-31-3)17(2)13-20/h5,7-15,25-26,29-30,33,36-37H,3-4,6,16H2,1-2H3,(H,32,34,35) |
| InChIKey | ONQPEMNBLHHOAQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 128.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|