C22H18BrN3 — CID 23909624
6-bromo-N-(3,4-dimethylphenyl)-2-phenylquinazolin-4-amine (PubChem CID 23909624) has the molecular formula C22H18BrN3 and a molecular weight of 404.31 g/mol. Its IUPAC name is 6-bromo-N-(3,4-dimethylphenyl)-2-phenylquinazolin-4-amine.
| Compound Name | 6-bromo-N-(3,4-dimethylphenyl)-2-phenylquinazolin-4-amine |
|---|---|
| PubChem CID | 23909624 |
| Molecular Formula | C22H18BrN3 |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 6-bromo-N-(3,4-dimethylphenyl)-2-phenylquinazolin-4-amine |
| SMILES | Cc1ccc(Nc2nc(-c3ccccc3)nc3ccc(Br)cc23)cc1C |
| InChI | InChI=1S/C22H18BrN3/c1-14-8-10-18(12-15(14)2)24-22-19-13-17(23)9-11-20(19)25-21(26-22)16-6-4-3-5-7-16/h3-13H,1-2H3,(H,24,25,26) |
| InChIKey | UFKVEMLURQKNKN-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |