C22H18FN3O — CID 20963104
N-(3-fluoro-4-methylphenyl)-2-(4-methoxyphenyl)quinazolin-4-amine (PubChem CID 20963104) has the molecular formula C22H18FN3O and a molecular weight of 359.40 g/mol. Its IUPAC name is N-(3-fluoro-4-methylphenyl)-2-(4-methoxyphenyl)quinazolin-4-amine.
| Compound Name | N-(3-fluoro-4-methylphenyl)-2-(4-methoxyphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 20963104 |
| Molecular Formula | C22H18FN3O |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | N-(3-fluoro-4-methylphenyl)-2-(4-methoxyphenyl)quinazolin-4-amine |
| SMILES | COc1ccc(-c2nc(Nc3ccc(C)c(F)c3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C22H18FN3O/c1-14-7-10-16(13-19(14)23)24-22-18-5-3-4-6-20(18)25-21(26-22)15-8-11-17(27-2)12-9-15/h3-13H,1-2H3,(H,24,25,26) |
| InChIKey | HUNCQEFODOZAKB-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |