C16H15FN4 — CID 80750621
4-N-(3-fluoro-4-methylphenyl)-2-N-methylquinazoline-2,4-diamine (PubChem CID 80750621) has the molecular formula C16H15FN4 and a molecular weight of 282.32 g/mol. Its IUPAC name is 4-N-(3-fluoro-4-methylphenyl)-2-N-methylquinazoline-2,4-diamine.
| Compound Name | 4-N-(3-fluoro-4-methylphenyl)-2-N-methylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 80750621 |
| Molecular Formula | C16H15FN4 |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 4-N-(3-fluoro-4-methylphenyl)-2-N-methylquinazoline-2,4-diamine |
| SMILES | CNc1nc(Nc2ccc(C)c(F)c2)c2ccccc2n1 |
| InChI | InChI=1S/C16H15FN4/c1-10-7-8-11(9-13(10)17)19-15-12-5-3-4-6-14(12)20-16(18-2)21-15/h3-9H,1-2H3,(H2,18,19,20,21) |
| InChIKey | LXSAWBMGIBITAA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |