C15H14BrN5 — CID 80911781
N-(4-bromo-3-methylphenyl)-2-hydrazinylquinazolin-4-amine (PubChem CID 80911781) has the molecular formula C15H14BrN5 and a molecular weight of 344.22 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-2-hydrazinylquinazolin-4-amine.
| Compound Name | N-(4-bromo-3-methylphenyl)-2-hydrazinylquinazolin-4-amine |
|---|---|
| PubChem CID | 80911781 |
| Molecular Formula | C15H14BrN5 |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-2-hydrazinylquinazolin-4-amine |
| SMILES | Cc1cc(Nc2nc(NN)nc3ccccc23)ccc1Br |
| InChI | InChI=1S/C15H14BrN5/c1-9-8-10(6-7-12(9)16)18-14-11-4-2-3-5-13(11)19-15(20-14)21-17/h2-8H,17H2,1H3,(H2,18,19,20,21) |
| InChIKey | GETRMPCQFXPMQU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|