C14H11Br2N5 — CID 107604857
N-(2,6-dibromophenyl)-2-hydrazinylquinazolin-4-amine (PubChem CID 107604857) has the molecular formula C14H11Br2N5 and a molecular weight of 409.09 g/mol. Its IUPAC name is N-(2,6-dibromophenyl)-2-hydrazinylquinazolin-4-amine.
| Compound Name | N-(2,6-dibromophenyl)-2-hydrazinylquinazolin-4-amine |
|---|---|
| PubChem CID | 107604857 |
| Molecular Formula | C14H11Br2N5 |
| Molecular Weight | 409.09 g/mol |
| Exact Mass | 406.94 |
| IUPAC Name | N-(2,6-dibromophenyl)-2-hydrazinylquinazolin-4-amine |
| SMILES | NNc1nc(Nc2c(Br)cccc2Br)c2ccccc2n1 |
| InChI | InChI=1S/C14H11Br2N5/c15-9-5-3-6-10(16)12(9)19-13-8-4-1-2-7-11(8)18-14(20-13)21-17/h1-7H,17H2,(H2,18,19,20,21) |
| InChIKey | PTBBXKHTLMYLBQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.09 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|