C31H36N6O4 — CID 134345067
4-N-[6-methoxy-7-(2-methoxyethoxy)-2-[3-[(3-propyloxiran-2-yl)amino]phenyl]quinazolin-4-yl]-2-methyl-1-N-(methylideneamino)benzene-1,4-diamine (PubChem CID 134345067) has the molecular formula C31H36N6O4 and a molecular weight of 556.67 g/mol. Its IUPAC name is 4-N-[6-methoxy-7-(2-methoxyethoxy)-2-[3-[(3-propyloxiran-2-yl)amino]phenyl]quinazolin-4-yl]-2-methyl-1-N-(methylideneamino)benzene-1,4-diamine.
| Compound Name | 4-N-[6-methoxy-7-(2-methoxyethoxy)-2-[3-[(3-propyloxiran-2-yl)amino]phenyl]quinazolin-4-yl]-2-methyl-1-N-(methylideneamino)benzene-1,4-diamine |
|---|---|
| PubChem CID | 134345067 |
| Molecular Formula | C31H36N6O4 |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | 4-N-[6-methoxy-7-(2-methoxyethoxy)-2-[3-[(3-propyloxiran-2-yl)amino]phenyl]quinazolin-4-yl]-2-methyl-1-N-(methylideneamino)benzene-1,4-diamine |
| SMILES | C=NNc1ccc(Nc2nc(-c3cccc(NC4OC4CCC)c3)nc3cc(OCCOC)c(OC)cc23)cc1C |
| InChI | InChI=1S/C31H36N6O4/c1-6-8-26-31(41-26)34-21-10-7-9-20(16-21)29-35-25-18-28(40-14-13-38-4)27(39-5)17-23(25)30(36-29)33-22-11-12-24(37-32-3)19(2)15-22/h7,9-12,15-18,26,31,34,37H,3,6,8,13-14H2,1-2,4-5H3,(H,33,35,36) |
| InChIKey | IXSYVCQLCGDBHA-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|