C20H21BrClN3O4 — CID 141376740
N-(3-bromophenyl)-2-chloro-6,7-bis(2-methoxyethoxy)quinazolin-4-amine (PubChem CID 141376740) has the molecular formula C20H21BrClN3O4 and a molecular weight of 482.76 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-chloro-6,7-bis(2-methoxyethoxy)quinazolin-4-amine.
| Compound Name | N-(3-bromophenyl)-2-chloro-6,7-bis(2-methoxyethoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 141376740 |
| Molecular Formula | C20H21BrClN3O4 |
| Molecular Weight | 482.76 g/mol |
| Exact Mass | 481.04 |
| IUPAC Name | N-(3-bromophenyl)-2-chloro-6,7-bis(2-methoxyethoxy)quinazolin-4-amine |
| SMILES | COCCOc1cc2nc(Cl)nc(Nc3cccc(Br)c3)c2cc1OCCOC |
| InChI | InChI=1S/C20H21BrClN3O4/c1-26-6-8-28-17-11-15-16(12-18(17)29-9-7-27-2)24-20(22)25-19(15)23-14-5-3-4-13(21)10-14/h3-5,10-12H,6-9H2,1-2H3,(H,23,24,25) |
| InChIKey | MKWFVJFWRIBMLB-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.76 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|