C23H24BrClN2O4 — CID 175765223
2-bromo-N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinolin-4-amine;hydrochloride (PubChem CID 175765223) has the molecular formula C23H24BrClN2O4 and a molecular weight of 507.81 g/mol. Its IUPAC name is 2-bromo-N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinolin-4-amine;hydrochloride.
| Compound Name | 2-bromo-N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 175765223 |
| Molecular Formula | C23H24BrClN2O4 |
| Molecular Weight | 507.81 g/mol |
| Exact Mass | 506.06 |
| IUPAC Name | 2-bromo-N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinolin-4-amine;hydrochloride |
| SMILES | C#Cc1cccc(Nc2cc(Br)nc3cc(OCCOC)c(OCCOC)cc23)c1.Cl |
| InChI | InChI=1S/C23H23BrN2O4.ClH/c1-4-16-6-5-7-17(12-16)25-20-15-23(24)26-19-14-22(30-11-9-28-3)21(13-18(19)20)29-10-8-27-2;/h1,5-7,12-15H,8-11H2,2-3H3,(H,25,26);1H |
| InChIKey | CRYUUYYNNMFNKC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.81 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|