C17H13ClN4O2 — CID 22693255
3-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]benzonitrile (PubChem CID 22693255) has the molecular formula C17H13ClN4O2 and a molecular weight of 340.77 g/mol. Its IUPAC name is 3-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]benzonitrile.
| Compound Name | 3-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 22693255 |
| Molecular Formula | C17H13ClN4O2 |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 3-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]benzonitrile |
| SMILES | COc1cc2nc(Cl)nc(Nc3cccc(C#N)c3)c2cc1OC |
| InChI | InChI=1S/C17H13ClN4O2/c1-23-14-7-12-13(8-15(14)24-2)21-17(18)22-16(12)20-11-5-3-4-10(6-11)9-19/h3-8H,1-2H3,(H,20,21,22) |
| InChIKey | NIKBRKRQNMWXQN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |