C31H23N5O3 — CID 71449339
4-[3-[[4-(3-ethynylanilino)-6,7-dimethoxyquinazolin-2-yl]amino]phenoxy]benzonitrile (PubChem CID 71449339) has the molecular formula C31H23N5O3 and a molecular weight of 513.56 g/mol. Its IUPAC name is 4-[3-[[4-(3-ethynylanilino)-6,7-dimethoxyquinazolin-2-yl]amino]phenoxy]benzonitrile.
| Compound Name | 4-[3-[[4-(3-ethynylanilino)-6,7-dimethoxyquinazolin-2-yl]amino]phenoxy]benzonitrile |
|---|---|
| PubChem CID | 71449339 |
| Molecular Formula | C31H23N5O3 |
| Molecular Weight | 513.56 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | 4-[3-[[4-(3-ethynylanilino)-6,7-dimethoxyquinazolin-2-yl]amino]phenoxy]benzonitrile |
| SMILES | C#Cc1cccc(Nc2nc(Nc3cccc(Oc4ccc(C#N)cc4)c3)nc3cc(OC)c(OC)cc23)c1 |
| InChI | InChI=1S/C31H23N5O3/c1-4-20-7-5-8-22(15-20)33-30-26-17-28(37-2)29(38-3)18-27(26)35-31(36-30)34-23-9-6-10-25(16-23)39-24-13-11-21(19-32)12-14-24/h1,5-18H,2-3H3,(H2,33,34,35,36) |
| InChIKey | CPFONAVDKCGKGK-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 101.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.56 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|