C22H18ClN3O3 — CID 122628510
N-[3-(3-chlorophenoxy)phenyl]-6,7-dimethoxyquinazolin-4-amine (PubChem CID 122628510) has the molecular formula C22H18ClN3O3 and a molecular weight of 407.86 g/mol. Its IUPAC name is N-[3-(3-chlorophenoxy)phenyl]-6,7-dimethoxyquinazolin-4-amine.
| Compound Name | N-[3-(3-chlorophenoxy)phenyl]-6,7-dimethoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 122628510 |
| Molecular Formula | C22H18ClN3O3 |
| Molecular Weight | 407.86 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | N-[3-(3-chlorophenoxy)phenyl]-6,7-dimethoxyquinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3cccc(Oc4cccc(Cl)c4)c3)c2cc1OC |
| InChI | InChI=1S/C22H18ClN3O3/c1-27-20-11-18-19(12-21(20)28-2)24-13-25-22(18)26-15-6-4-8-17(10-15)29-16-7-3-5-14(23)9-16/h3-13H,1-2H3,(H,24,25,26) |
| InChIKey | XOLVLMYPUWWPBC-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.86 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |