C23H20ClN3O3 — CID 122628743
N-[4-(3-chlorophenoxy)-2-methylphenyl]-6,7-dimethoxyquinazolin-4-amine (PubChem CID 122628743) has the molecular formula C23H20ClN3O3 and a molecular weight of 421.88 g/mol. Its IUPAC name is N-[4-(3-chlorophenoxy)-2-methylphenyl]-6,7-dimethoxyquinazolin-4-amine.
| Compound Name | N-[4-(3-chlorophenoxy)-2-methylphenyl]-6,7-dimethoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 122628743 |
| Molecular Formula | C23H20ClN3O3 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | N-[4-(3-chlorophenoxy)-2-methylphenyl]-6,7-dimethoxyquinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3ccc(Oc4cccc(Cl)c4)cc3C)c2cc1OC |
| InChI | InChI=1S/C23H20ClN3O3/c1-14-9-17(30-16-6-4-5-15(24)10-16)7-8-19(14)27-23-18-11-21(28-2)22(29-3)12-20(18)25-13-26-23/h4-13H,1-3H3,(H,25,26,27) |
| InChIKey | XRJIMXHLKIVNEY-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |