C26H26N4O3 — CID 155680236
1-[4-[4-(3-ethynylanilino)-7-methoxy-2-methylquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one (PubChem CID 155680236) has the molecular formula C26H26N4O3 and a molecular weight of 442.52 g/mol. Its IUPAC name is 1-[4-[4-(3-ethynylanilino)-7-methoxy-2-methylquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[4-(3-ethynylanilino)-7-methoxy-2-methylquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155680236 |
| Molecular Formula | C26H26N4O3 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 1-[4-[4-(3-ethynylanilino)-7-methoxy-2-methylquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
| SMILES | C#Cc1cccc(Nc2nc(C)nc3cc(OC)c(OC4CCN(C(=O)C=C)CC4)cc23)c1 |
| InChI | InChI=1S/C26H26N4O3/c1-5-18-8-7-9-19(14-18)29-26-21-15-24(23(32-4)16-22(21)27-17(3)28-26)33-20-10-12-30(13-11-20)25(31)6-2/h1,6-9,14-16,20H,2,10-13H2,3-4H3,(H,27,28,29) |
| InChIKey | KCUMWNMCFBTFEJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|