C25H26N4O4 — CID 58294929
N-[4-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxycyclohexyl]-2-hydroxyacetamide (PubChem CID 58294929) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is N-[4-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxycyclohexyl]-2-hydroxyacetamide.
| Compound Name | N-[4-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxycyclohexyl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 58294929 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | N-[4-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxycyclohexyl]-2-hydroxyacetamide |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OC)c(OC4CCC(NC(=O)CO)CC4)cc23)c1 |
| InChI | InChI=1S/C25H26N4O4/c1-3-16-5-4-6-18(11-16)29-25-20-12-23(22(32-2)13-21(20)26-15-27-25)33-19-9-7-17(8-10-19)28-24(31)14-30/h1,4-6,11-13,15,17,19,30H,7-10,14H2,2H3,(H,28,31)(H,26,27,29) |
| InChIKey | DPQMJPOEELUVIT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|