C30H29FN4O4 — CID 166086373
1-[4-[4-[5-(4-fluorophenyl)-2-methoxyanilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one (PubChem CID 166086373) has the molecular formula C30H29FN4O4 and a molecular weight of 528.58 g/mol. Its IUPAC name is 1-[4-[4-[5-(4-fluorophenyl)-2-methoxyanilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[4-[5-(4-fluorophenyl)-2-methoxyanilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166086373 |
| Molecular Formula | C30H29FN4O4 |
| Molecular Weight | 528.58 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | 1-[4-[4-[5-(4-fluorophenyl)-2-methoxyanilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(Oc2cc3c(Nc4cc(-c5ccc(F)cc5)ccc4OC)ncnc3cc2OC)CC1 |
| InChI | InChI=1S/C30H29FN4O4/c1-4-29(36)35-13-11-22(12-14-35)39-28-16-23-24(17-27(28)38-3)32-18-33-30(23)34-25-15-20(7-10-26(25)37-2)19-5-8-21(31)9-6-19/h4-10,15-18,22H,1,11-14H2,2-3H3,(H,32,33,34) |
| InChIKey | IIKUACDTWBISGL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.58 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|