C31H32FN5O4 — CID 166086418
1-[4-[4-[5-(5-amino-4-fluoro-2-methylphenyl)-2-methoxyanilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one (PubChem CID 166086418) has the molecular formula C31H32FN5O4 and a molecular weight of 557.63 g/mol. Its IUPAC name is 1-[4-[4-[5-(5-amino-4-fluoro-2-methylphenyl)-2-methoxyanilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[4-[5-(5-amino-4-fluoro-2-methylphenyl)-2-methoxyanilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166086418 |
| Molecular Formula | C31H32FN5O4 |
| Molecular Weight | 557.63 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | 1-[4-[4-[5-(5-amino-4-fluoro-2-methylphenyl)-2-methoxyanilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(Oc2cc3c(Nc4cc(-c5cc(N)c(F)cc5C)ccc4OC)ncnc3cc2OC)CC1 |
| InChI | InChI=1S/C31H32FN5O4/c1-5-30(38)37-10-8-20(9-11-37)41-29-15-22-25(16-28(29)40-4)34-17-35-31(22)36-26-13-19(6-7-27(26)39-3)21-14-24(33)23(32)12-18(21)2/h5-7,12-17,20H,1,8-11,33H2,2-4H3,(H,34,35,36) |
| InChIKey | XWUFZDATBMJOIN-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 111.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.63 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|