C32H30F2N4O4 — CID 167215880
1-[4-[4-[2-cyclopropyloxy-5-(2,4-difluorophenyl)anilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one (PubChem CID 167215880) has the molecular formula C32H30F2N4O4 and a molecular weight of 572.61 g/mol. Its IUPAC name is 1-[4-[4-[2-cyclopropyloxy-5-(2,4-difluorophenyl)anilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[4-[2-cyclopropyloxy-5-(2,4-difluorophenyl)anilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167215880 |
| Molecular Formula | C32H30F2N4O4 |
| Molecular Weight | 572.61 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | 1-[4-[4-[2-cyclopropyloxy-5-(2,4-difluorophenyl)anilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(Oc2cc3c(Nc4cc(-c5ccc(F)cc5F)ccc4OC4CC4)ncnc3cc2OC)CC1 |
| InChI | InChI=1S/C32H30F2N4O4/c1-3-31(39)38-12-10-22(11-13-38)42-30-16-24-26(17-29(30)40-2)35-18-36-32(24)37-27-14-19(4-9-28(27)41-21-6-7-21)23-8-5-20(33)15-25(23)34/h3-5,8-9,14-18,21-22H,1,6-7,10-13H2,2H3,(H,35,36,37) |
| InChIKey | NSAYRUBIZQFNTG-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.61 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|