C30H25F5N4O4 — CID 167216070
1-[4-[7-methoxy-4-[2-methoxy-5-(2,3,4,5,6-pentafluorophenyl)anilino]quinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one (PubChem CID 167216070) has the molecular formula C30H25F5N4O4 and a molecular weight of 600.54 g/mol. Its IUPAC name is 1-[4-[7-methoxy-4-[2-methoxy-5-(2,3,4,5,6-pentafluorophenyl)anilino]quinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[7-methoxy-4-[2-methoxy-5-(2,3,4,5,6-pentafluorophenyl)anilino]quinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167216070 |
| Molecular Formula | C30H25F5N4O4 |
| Molecular Weight | 600.54 g/mol |
| Exact Mass | 600.18 |
| IUPAC Name | 1-[4-[7-methoxy-4-[2-methoxy-5-(2,3,4,5,6-pentafluorophenyl)anilino]quinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(Oc2cc3c(Nc4cc(-c5c(F)c(F)c(F)c(F)c5F)ccc4OC)ncnc3cc2OC)CC1 |
| InChI | InChI=1S/C30H25F5N4O4/c1-4-23(40)39-9-7-16(8-10-39)43-22-12-17-18(13-21(22)42-3)36-14-37-30(17)38-19-11-15(5-6-20(19)41-2)24-25(31)27(33)29(35)28(34)26(24)32/h4-6,11-14,16H,1,7-10H2,2-3H3,(H,36,37,38) |
| InChIKey | NUEFGCRCPXDSFI-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.54 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|