C28H32N4O5 — CID 166086185
1-[4-[7-methoxy-4-[2-methoxy-5-(oxolan-2-yl)anilino]quinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one (PubChem CID 166086185) has the molecular formula C28H32N4O5 and a molecular weight of 504.59 g/mol. Its IUPAC name is 1-[4-[7-methoxy-4-[2-methoxy-5-(oxolan-2-yl)anilino]quinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[7-methoxy-4-[2-methoxy-5-(oxolan-2-yl)anilino]quinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166086185 |
| Molecular Formula | C28H32N4O5 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | 1-[4-[7-methoxy-4-[2-methoxy-5-(oxolan-2-yl)anilino]quinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(Oc2cc3c(Nc4cc(C5CCCO5)ccc4OC)ncnc3cc2OC)CC1 |
| InChI | InChI=1S/C28H32N4O5/c1-4-27(33)32-11-9-19(10-12-32)37-26-15-20-21(16-25(26)35-3)29-17-30-28(20)31-22-14-18(7-8-24(22)34-2)23-6-5-13-36-23/h4,7-8,14-17,19,23H,1,5-6,9-13H2,2-3H3,(H,29,30,31) |
| InChIKey | WKEWQMGHBCSJMU-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|