C15H13ClN4O2 — CID 22692875
2-chloro-6,7-dimethoxy-N-pyridin-2-ylquinazolin-4-amine (PubChem CID 22692875) has the molecular formula C15H13ClN4O2 and a molecular weight of 316.75 g/mol. Its IUPAC name is 2-chloro-6,7-dimethoxy-N-pyridin-2-ylquinazolin-4-amine.
| Compound Name | 2-chloro-6,7-dimethoxy-N-pyridin-2-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 22692875 |
| Molecular Formula | C15H13ClN4O2 |
| Molecular Weight | 316.75 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 2-chloro-6,7-dimethoxy-N-pyridin-2-ylquinazolin-4-amine |
| SMILES | COc1cc2nc(Cl)nc(Nc3ccccn3)c2cc1OC |
| InChI | InChI=1S/C15H13ClN4O2/c1-21-11-7-9-10(8-12(11)22-2)18-15(16)20-14(9)19-13-5-3-4-6-17-13/h3-8H,1-2H3,(H,17,18,19,20) |
| InChIKey | JNHCKGUWJJNEPR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.75 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |