C17H16ClN3O3 — CID 22692956
2-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]-4-methylphenol (PubChem CID 22692956) has the molecular formula C17H16ClN3O3 and a molecular weight of 345.79 g/mol. Its IUPAC name is 2-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]-4-methylphenol.
| Compound Name | 2-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]-4-methylphenol |
|---|---|
| PubChem CID | 22692956 |
| Molecular Formula | C17H16ClN3O3 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 2-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]-4-methylphenol |
| SMILES | COc1cc2nc(Cl)nc(Nc3cc(C)ccc3O)c2cc1OC |
| InChI | InChI=1S/C17H16ClN3O3/c1-9-4-5-13(22)12(6-9)19-16-10-7-14(23-2)15(24-3)8-11(10)20-17(18)21-16/h4-8,22H,1-3H3,(H,19,20,21) |
| InChIKey | SEHHYSLZDYXENC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|