C16H14ClN3O6S — CID 22693033
3-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]-4-hydroxybenzenesulfonic acid (PubChem CID 22693033) has the molecular formula C16H14ClN3O6S and a molecular weight of 411.82 g/mol. Its IUPAC name is 3-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]-4-hydroxybenzenesulfonic acid.
| Compound Name | 3-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]-4-hydroxybenzenesulfonic acid |
|---|---|
| PubChem CID | 22693033 |
| Molecular Formula | C16H14ClN3O6S |
| Molecular Weight | 411.82 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | 3-[(2-chloro-6,7-dimethoxyquinazolin-4-yl)amino]-4-hydroxybenzenesulfonic acid |
| SMILES | COc1cc2nc(Cl)nc(Nc3cc(S(=O)(=O)O)ccc3O)c2cc1OC |
| InChI | InChI=1S/C16H14ClN3O6S/c1-25-13-6-9-10(7-14(13)26-2)19-16(17)20-15(9)18-11-5-8(27(22,23)24)3-4-12(11)21/h3-7,21H,1-2H3,(H,18,19,20)(H,22,23,24) |
| InChIKey | GDSFVMPAPBLNCD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 130.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.82 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|