C16H12BrClN4O4 — CID 22693181
N-(2-bromo-5-nitrophenyl)-2-chloro-6,7-dimethoxyquinazolin-4-amine (PubChem CID 22693181) has the molecular formula C16H12BrClN4O4 and a molecular weight of 439.65 g/mol. Its IUPAC name is N-(2-bromo-5-nitrophenyl)-2-chloro-6,7-dimethoxyquinazolin-4-amine.
| Compound Name | N-(2-bromo-5-nitrophenyl)-2-chloro-6,7-dimethoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 22693181 |
| Molecular Formula | C16H12BrClN4O4 |
| Molecular Weight | 439.65 g/mol |
| Exact Mass | 437.97 |
| IUPAC Name | N-(2-bromo-5-nitrophenyl)-2-chloro-6,7-dimethoxyquinazolin-4-amine |
| SMILES | COc1cc2nc(Cl)nc(Nc3cc([N+](=O)[O-])ccc3Br)c2cc1OC |
| InChI | InChI=1S/C16H12BrClN4O4/c1-25-13-6-9-11(7-14(13)26-2)20-16(18)21-15(9)19-12-5-8(22(23)24)3-4-10(12)17/h3-7H,1-2H3,(H,19,20,21) |
| InChIKey | OGEOVWIMIWJJIE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.65 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|