C9H8BrN3O2 — CID 69096710
N-(2-bromo-5-nitrophenyl)-2,3-dihydroazet-4-amine (PubChem CID 69096710) has the molecular formula C9H8BrN3O2 and a molecular weight of 270.09 g/mol. Its IUPAC name is N-(2-bromo-5-nitrophenyl)-2,3-dihydroazet-4-amine.
| Compound Name | N-(2-bromo-5-nitrophenyl)-2,3-dihydroazet-4-amine |
|---|---|
| PubChem CID | 69096710 |
| Molecular Formula | C9H8BrN3O2 |
| Molecular Weight | 270.09 g/mol |
| Exact Mass | 268.98 |
| IUPAC Name | N-(2-bromo-5-nitrophenyl)-2,3-dihydroazet-4-amine |
| SMILES | O=[N+]([O-])c1ccc(Br)c(NC2=NCC2)c1 |
| InChI | InChI=1S/C9H8BrN3O2/c10-7-2-1-6(13(14)15)5-8(7)12-9-3-4-11-9/h1-2,5H,3-4H2,(H,11,12) |
| InChIKey | KHWJLQHIUXEUQI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.09 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|