About 2-bromo-5-nitroaniline;N-(2-bromo-5-nitrophenyl)acetamide
2-bromo-5-nitroaniline;N-(2-bromo-5-nitrophenyl)acetamide (PubChem CID 87757887) has the molecular formula C14H12Br2N4O5
and a molecular weight of 476.08 g/mol. Its IUPAC name is 2-bromo-5-nitroaniline;N-(2-bromo-5-nitrophenyl)acetamide.
Molecular Properties
| Compound Name | 2-bromo-5-nitroaniline;N-(2-bromo-5-nitrophenyl)acetamide |
| PubChem CID | 87757887 |
| Molecular Formula | C14H12Br2N4O5 |
| Molecular Weight | 476.08 g/mol |
| Exact Mass | 473.92 |
| IUPAC Name | 2-bromo-5-nitroaniline;N-(2-bromo-5-nitrophenyl)acetamide |
| SMILES | CC(=O)Nc1cc([N+](=O)[O-])ccc1Br.Nc1cc([N+](=O)[O-])ccc1Br |
| InChI | InChI=1S/C8H7BrN2O3.C6H5BrN2O2/c1-5(12)10-8-4-6(11(13)14)2-3-7(8)9;7-5-2-1-4(9(10)11)3-6(5)8/h2-4H,1H3,(H,10,12);1-3H,8H2 |
| InChIKey | BLYHODCDSQKHOV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 141.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 476.08 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-5-nitroaniline;N-(2-bromo-5-nitrophenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-nitroaniline;N-(2-bromo-5-nitrophenyl)acetamide?
The IUPAC name of 2-bromo-5-nitroaniline;N-(2-bromo-5-nitrophenyl)acetamide (CID 87757887) is 2-bromo-5-nitroaniline;N-(2-bromo-5-nitrophenyl)acetamide.
What is the SMILES notation for 2-bromo-5-nitroaniline;N-(2-bromo-5-nitrophenyl)acetamide?
The canonical SMILES for 2-bromo-5-nitroaniline;N-(2-bromo-5-nitrophenyl)acetamide is CC(=O)Nc1cc([N+](=O)[O-])ccc1Br.Nc1cc([N+](=O)[O-])ccc1Br.
What is the InChIKey of 2-bromo-5-nitroaniline;N-(2-bromo-5-nitrophenyl)acetamide?
The InChIKey is BLYHODCDSQKHOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrN2O3.C6H5BrN2O2/c1-5(12)10-8-4-6(11(13)14)2-3-7(8)9;7-5-2-1-4(9(10)11)3-6(5)8/h2-4H,1H3,(H,10,12);1-3H,8H2.
What are the key properties of 2-bromo-5-nitroaniline;N-(2-bromo-5-nitrophenyl)acetamide?
2-bromo-5-nitroaniline;N-(2-bromo-5-nitrophenyl)acetamide has a molecular weight of 476.08 g/mol, XLogP of 4.26, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-nitroaniline;N-(2-bromo-5-nitrophenyl)acetamide is sourced from PubChem (CID 87757887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).