C16H15N5O4 — CID 57328727
6,7-dimethoxy-2-N-(4-nitrophenyl)quinazoline-2,4-diamine (PubChem CID 57328727) has the molecular formula C16H15N5O4 and a molecular weight of 341.33 g/mol. Its IUPAC name is 6,7-dimethoxy-2-N-(4-nitrophenyl)quinazoline-2,4-diamine.
| Compound Name | 6,7-dimethoxy-2-N-(4-nitrophenyl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 57328727 |
| Molecular Formula | C16H15N5O4 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 6,7-dimethoxy-2-N-(4-nitrophenyl)quinazoline-2,4-diamine |
| SMILES | COc1cc2nc(Nc3ccc([N+](=O)[O-])cc3)nc(N)c2cc1OC |
| InChI | InChI=1S/C16H15N5O4/c1-24-13-7-11-12(8-14(13)25-2)19-16(20-15(11)17)18-9-3-5-10(6-4-9)21(22)23/h3-8H,1-2H3,(H3,17,18,19,20) |
| InChIKey | ORYYJRMHBJFMHX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|