C11H8N2O5 — CID 87433363
3-methoxy-4-(4-nitroanilino)cyclobut-3-ene-1,2-dione (PubChem CID 87433363) has the molecular formula C11H8N2O5 and a molecular weight of 248.19 g/mol. Its IUPAC name is 3-methoxy-4-(4-nitroanilino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-methoxy-4-(4-nitroanilino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 87433363 |
| Molecular Formula | C11H8N2O5 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 3-methoxy-4-(4-nitroanilino)cyclobut-3-ene-1,2-dione |
| SMILES | COc1c(Nc2ccc([N+](=O)[O-])cc2)c(=O)c1=O |
| InChI | InChI=1S/C11H8N2O5/c1-18-11-8(9(14)10(11)15)12-6-2-4-7(5-3-6)13(16)17/h2-5,12H,1H3 |
| InChIKey | NSOGLROPNSOBEI-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|