C17H22N4O5 — CID 174278875
3,6-dimethoxy-1-N,2-N,4-N-trimethyl-5-(4-nitrophenoxy)benzene-1,2,4-triamine (PubChem CID 174278875) has the molecular formula C17H22N4O5 and a molecular weight of 362.39 g/mol. Its IUPAC name is 3,6-dimethoxy-1-N,2-N,4-N-trimethyl-5-(4-nitrophenoxy)benzene-1,2,4-triamine.
| Compound Name | 3,6-dimethoxy-1-N,2-N,4-N-trimethyl-5-(4-nitrophenoxy)benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 174278875 |
| Molecular Formula | C17H22N4O5 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 3,6-dimethoxy-1-N,2-N,4-N-trimethyl-5-(4-nitrophenoxy)benzene-1,2,4-triamine |
| SMILES | CNc1c(NC)c(OC)c(Oc2ccc([N+](=O)[O-])cc2)c(NC)c1OC |
| InChI | InChI=1S/C17H22N4O5/c1-18-12-13(19-2)16(25-5)17(14(20-3)15(12)24-4)26-11-8-6-10(7-9-11)21(22)23/h6-9,18-20H,1-5H3 |
| InChIKey | SAIQMZUWFWEENS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|