C14H13NO8 — CID 166787691
2,4-dimethoxy-6-(4-nitrophenoxy)benzene-1,3,5-triol (PubChem CID 166787691) has the molecular formula C14H13NO8 and a molecular weight of 323.26 g/mol. Its IUPAC name is 2,4-dimethoxy-6-(4-nitrophenoxy)benzene-1,3,5-triol.
| Compound Name | 2,4-dimethoxy-6-(4-nitrophenoxy)benzene-1,3,5-triol |
|---|---|
| PubChem CID | 166787691 |
| Molecular Formula | C14H13NO8 |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 2,4-dimethoxy-6-(4-nitrophenoxy)benzene-1,3,5-triol |
| SMILES | COc1c(O)c(OC)c(O)c(Oc2ccc([N+](=O)[O-])cc2)c1O |
| InChI | InChI=1S/C14H13NO8/c1-21-12-9(16)13(22-2)11(18)14(10(12)17)23-8-5-3-7(4-6-8)15(19)20/h3-6,16-18H,1-2H3 |
| InChIKey | RSNAHQIQFXFHBC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|