C16H14N6O4 — CID 135489919
6-(4-methoxyanilino)-4-(4-nitroanilino)-1H-1,3,5-triazin-2-one (PubChem CID 135489919) has the molecular formula C16H14N6O4 and a molecular weight of 354.33 g/mol. Its IUPAC name is 6-(4-methoxyanilino)-4-(4-nitroanilino)-1H-1,3,5-triazin-2-one.
| Compound Name | 6-(4-methoxyanilino)-4-(4-nitroanilino)-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 135489919 |
| Molecular Formula | C16H14N6O4 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 6-(4-methoxyanilino)-4-(4-nitroanilino)-1H-1,3,5-triazin-2-one |
| SMILES | COc1ccc(Nc2nc(Nc3ccc([N+](=O)[O-])cc3)nc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C16H14N6O4/c1-26-13-8-4-11(5-9-13)18-15-19-14(20-16(23)21-15)17-10-2-6-12(7-3-10)22(24)25/h2-9H,1H3,(H3,17,18,19,20,21,23) |
| InChIKey | OVMFYLSJXIBCKN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 135.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|