C13H12N2O5 — CID 46868409
3-ethoxy-4-[(4-nitrophenyl)methylamino]cyclobut-3-ene-1,2-dione (PubChem CID 46868409) has the molecular formula C13H12N2O5 and a molecular weight of 276.25 g/mol. Its IUPAC name is 3-ethoxy-4-[(4-nitrophenyl)methylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-ethoxy-4-[(4-nitrophenyl)methylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 46868409 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 3-ethoxy-4-[(4-nitrophenyl)methylamino]cyclobut-3-ene-1,2-dione |
| SMILES | CCOc1c(NCc2ccc([N+](=O)[O-])cc2)c(=O)c1=O |
| InChI | InChI=1S/C13H12N2O5/c1-2-20-13-10(11(16)12(13)17)14-7-8-3-5-9(6-4-8)15(18)19/h3-6,14H,2,7H2,1H3 |
| InChIKey | KFAXQZAGDYPLQJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|